2260670-60-6
Chemical Structure
04:1 Coenzyme A trisodium
- CAS No.: 2260670-60-6
- Formula:C25H37N7Na3O17P3S
- Molecular Weight:901.55
InChIKey: XIHHSPKQIZSOBG-OUWZIDFPSA-K
SMILES: O[C@@H]1[C@H](OP(O)(O[Na])=O)[C@@H](COP(OP(OCC(C)([C@H](C(NCCC(NCCSC(/C=C/C)=O)=O)=O)O)C)(O[Na])=O)(O[Na])=O)O[C@H]1N2C3=NC=NC(N)=C3N=C2
Biological Activity: 04:1 Coenzyme A is a biochemical reagent that is a specific form of coenzyme A (CoA), "04:1" usually indicates that the acyl chain of the CoA contains four carbon atoms and one double bond. 04:1 Coenzyme A can be used to study specific biochemical reactions or pathways[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
04:1 Coenzyme A trisodium | 04:1 Coenzyme A is a biochemical reagent that is a specific form of coenzyme A (CoA), "04:1" usually indicates that the acyl chain of the CoA contains four carbon atoms and one double bond. 04:1 Coenzyme A can be used to study specific biochemical reactions or pathways. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||