2320560-36-7
Chemical Structure
2-(Azido-PEG3-amido)-1,3-bis(NHS ester)
- CAS No.: 2320560-36-7
- Formula:C26H38N6O14
- Molecular Weight:658.61
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 1-azido-14-((3-((2,5-dioxopyrrolidin-1-yl)oxy)-3-oxopropoxy)methyl)-12-oxo-3,6,9,16-tetraoxa-13-azanonadecan-19-oate
InChIKey: IKNSPJWCHQONRB-UHFFFAOYSA-N
SMILES: O=C(NC(COCCC(ON1C(CCC1=O)=O)=O)COCCC(ON2C(CCC2=O)=O)=O)CCOCCOCCOCCN=[N+]=[N-]
Biological Activity: 2-(Azido-PEG3-amido)-1,3-bis(NHS ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. 2-(Azido-PEG3-amido)-1,3-bis(NHS ester) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2-(Azido-PEG3-amido)-1,3-bis(NHS ester) | 2-(Azido-PEG3-amido)-1,3-bis(NHS ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. 2-(Azido-PEG3-amido)-1,3-bis(NHS ester) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
