2322322-57-4
Chemical Structure
Cy3-N3
- CAS No.: 2322322-57-4
- Formula:C34H44N6O7S2
- Molecular Weight:712.88
IUPAC Name: 2-((E)-3-((Z)-1-(6-((3-azidopropyl)amino)-6-oxohexyl)-3,3-dimethyl-5-sulfoindolin-2-ylidene)prop-1-en-1-yl)-1-ethyl-3,3-dimethyl-3H-indol-1-ium-5-sulfonate
InChIKey: QZHNJGITBNPVKI-UHFFFAOYSA-N
SMILES: CC1(C)C(/C=C/C=C2N(CCCCCC(NCCCN=[N+]=[N-])=O)C(C=CC(S(=O)(O)=O)=C3)=C3C\2(C)C)=[N+](CC)C4=CC=C([S-](=O)(=O)=O)C=C41
Biological Activity: Cy3-N3 is a Cy3-azide fluorescent dye used to label for protein and nucleic acid. Cy3-N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups (Ex/Em = 548/563 nm).
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cy3-N3 | 96.39% | Cy3-N3 is a Cy3-azide fluorescent dye used to label for protein and nucleic acid. Cy3-N3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups (Ex/Em = 548/563 nm). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords