2375849-11-7
Chemical Structure
HYNIC-iPSMA TFA
- CAS. Nr.: 2375849-11-7
- Formula:C33H38F3N7O11
- Molecular Weight:765.69
InChIKey: PKIAQERMYBSXOA-NYTZCTPBSA-N
SMILES: OC(C(F)(F)F)=O.O=C(C(C=C/1)=CNC1=N\N)N[C@H](C(NCCCC[C@@H](C(O)=O)NC(N[C@H](C(O)=O)CCC(O)=O)=O)=O)CC2=CC3=C(C=CC=C3)C=C2
Biological Activity: HYNIC-iPSMA TFA is a ligand for molecular imaging of tumors. Hynic-ipsma consists of two components: HYNIC (6-hydrazinonicotinamide) and iPSMA (Inhibitor of Prostate-Specific Membrane Antigen). HYNIC is a compound used to attach radioactive isotopes to targeted molecules. iPSMA is a specific inhibitor used to inhibit prostate-specific membrane antigen (PSMA). 68GA-labeled iPSMA has been used to detect prostate cancer by PET imaging. The further 99mTc-EDDA/HYNIC-iPSMA TFA has excellent specificity and sensitivity[1]. HYNIC-iPSMA TFA can be used for the synthesis/research of Radionuclide-Drug Conjugates (RDCs).
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
HYNIC-iPSMA TFA | 98.05% | HYNIC-iPSMA TFA is a ligand for molecular imaging of tumors. Hynic-ipsma consists of two components: HYNIC (6-hydrazinonicotinamide) and iPSMA (Inhibitor of Prostate-Specific Membrane Antigen). HYNIC is a compound used to attach radioactive isotopes to targeted molecules. iPSMA is a specific inhibitor used to inhibit prostate-specific membrane antigen (PSMA). 68GA-labeled iPSMA has been used to detect prostate cancer by PET imaging. The further 99mTc-EDDA/HYNIC-iPSMA TFA has excellent specificity and sensitivity. HYNIC-iPSMA TFA can be used for the synthesis/research of Radionuclide-Drug Conjugates (RDCs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
