2378004-17-0
Chemical Structure
5'-Aqp 593 Phosphoramidite hexafluorophosphate
- CAS No.: 2378004-17-0
- Formula:C57H78F9N6O8P3
- Molecular Weight:1239.17
InChIKey: DWHRLIUARJHFGF-UHFFFAOYSA-O
SMILES: O=P(OCCCCNC(C(F)(F)F)=O)(C1=CC(C2=C(C=C3C4=C5CCCN4CCC3)C5=[O+]C6=C2C=C7C8=C6CCCN8CCC7)=C(C(N(CC)CC)=O)C=C1)OCCCCCCOP(OCCC#N)N(C(C)C)C(C)C.[F-][P+5]([F-])([F-])([F-])([F-])[F-]
Biological Activity: 5'-Aqp 593 Phosphoramidite hexafluorophosphate is a cyanin-based fluorescent phosphoridamide monomer suitable for solid-phase oligonucleotide synthesis. It allows for site-specific labeling of the 5' end of DNA and RNA with the AquaPhluor 593 fluorescent dye. 5'-Aqp 593 Phosphoramidite hexafluorophosphate can be used to synthesize 5'-terminal fluorescently labeled oligonucleotides for various fluorescence experiments.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5'-Aqp 593 Phosphoramidite hexafluorophosphate | 5'-Aqp 593 Phosphoramidite hexafluorophosphate is a cyanin-based fluorescent phosphoridamide monomer suitable for solid-phase oligonucleotide synthesis. It allows for site-specific labeling of the 5' end of DNA and RNA with the AquaPhluor 593 fluorescent dye. 5'-Aqp 593 Phosphoramidite hexafluorophosphate can be used to synthesize 5'-terminal fluorescently labeled oligonucleotides for various fluorescence experiments. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
