23911-26-4
Chemical Structure
DTPA anhydride
- CAS No.: 23911-26-4
- Formula:C14H19N3O8
- Molecular Weight:357.32
IUPAC Name: bis(2-(2,6-dioxomorpholino)ethyl)glycine
InChIKey: RAZLJUXJEOEYAM-UHFFFAOYSA-N
SMILES: O=C(CN(CCN1CC(OC(C1)=O)=O)CCN2CC(OC(C2)=O)=O)O
Biological Activity: DTPA anhydride is a bifunctional chelator whose anhydride can react with amino groups in proteins (such as lysine residues) to form stable amide bonds. DTPA anhydride can also bind to radionuclides to synthesize radionuclide-labeled drug conjugates (RDCs). RDCs have the ability to specifically target biomolecules and can be used in medical imaging or therapy.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DTPA anhydride | 97.0% | DTPA anhydride is a bifunctional chelator whose anhydride can react with amino groups in proteins (such as lysine residues) to form stable amide bonds. DTPA anhydride can also bind to radionuclides to synthesize radionuclide-labeled drug conjugates (RDCs). RDCs have the ability to specifically target biomolecules and can be used in medical imaging or therapy. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||