24345-74-2
Chemical Structure
Azido-PEG1-azide
- CAS No.: 24345-74-2
- Formula:C4H8N6O
- Molecular Weight:156.15
IUPAC Name: 1-azido-2-(2-azidoethoxy)ethane
InChIKey: NQEPBRYUGPSVPU-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG1-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG1-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG1-azide | 99.11% | Azido-PEG1-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG1-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords