2485715-97-5
Chemical Structure
Cap-dependent endonuclease-IN-7
- CAS No.: 2485715-97-5
- Formula:C36H28FN3O7S
- Molecular Weight:665.69
IUPAC Name: (((R)-12-((S)-5-fluoro-2-phenyl-8H-dibenzo[3,4:6,7]cyclohepta[1,2-b]thiophen-8-yl)-6,8-dioxo-3,4,6,8,12,12a-hexahydro-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazin-7-yl)oxy)methyl methyl carbonate
InChIKey: WNRPSAKVRGSUJM-FIRIVFDPSA-N
SMILES: O=C(OC)OCOC(C(C=C1)=O)=C(N1N([C@H](C2=CC=CC=C23)C4=CC=C(F)C=C4C5=C3SC(C6=CC=CC=C6)=C5)[C@@]7([H])N8CCOC7)C8=O
Biological Activity: Cap-dependent endonuclease-IN-7 is a potent inhibitor of cap-dependent endonuclease (CEN). Cap-dependent endonuclease-IN-7 Inhibits the synthesis of viral mRNA and eventually inhibits virus proliferation. Cap-dependent endonuclease-IN-7 has the potential for the research of viral infections (including influenza A, influenza B and influenza C) (extracted from patent WO2020177715A1, compound 5)[1]
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cap-dependent endonuclease-IN-7 | Cap-dependent endonuclease-IN-7 is a potent inhibitor of cap-dependent endonuclease (CEN). Cap-dependent endonuclease-IN-7 Inhibits the synthesis of viral mRNA and eventually inhibits virus proliferation. Cap-dependent endonuclease-IN-7 has the potential for the research of viral infections (including influenza A, influenza B and influenza C) (extracted from patent WO2020177715A1, compound 5) | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||