2505218-38-0
Chemical Structure
Ferroptocide
- CAS No.: 2505218-38-0
- Formula:C30H36ClN3O7
- Molecular Weight:586.08
InChIKey: LLYJISDUHFXOHK-GOCONZMPSA-N
SMILES: O[C@@]12[C@@]3(C[C@@H](C2=O)O)[C@H]([C@H](C4=CCN(C(N(C5=CC=CC=C5)C6=O)=O)N6C4)C[C@H]([C@@]1([C@@H](CC3)C)C)OC(CCl)=O)C
Biological Activity: Ferroptocide is a cell death inducer that triggers ferroptosis and has anti-tumor activity. Ferroptocide can induce oxidative stress, leading to G2/M cell cycle arrest and apoptosis activation in LNCaP cells, while also effectively inhibiting the cell viability of both LNCaP and TRAMP-C1 cells. Ferroptocide can be used to study its capability to induce mitochondrial autophagy and to trigger immunogenic cell death (ICD) in prostate cancer cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ferroptocide | 95.0% | Ferroptocide is a cell death inducer that triggers ferroptosis and has anti-tumor activity. Ferroptocide can induce oxidative stress, leading to G2/M cell cycle arrest and apoptosis activation in LNCaP cells, while also effectively inhibiting the cell viability of both LNCaP and TRAMP-C1 cells. Ferroptocide can be used to study its capability to induce mitochondrial autophagy and to trigger immunogenic cell death (ICD) in prostate cancer cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
