2584414-13-9
Chemical Structure
Obtusinaphthalenside B
- CAS No.: 2584414-13-9
- Formula:C19H22O10
- Molecular Weight:410.37
InChIKey: OKCJDSRWKSBJJA-JZXZQAMYSA-N
SMILES: OC1=C(C(C)=O)C(O[C@@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO)=CC3=C1C(OC)=CC(O)=C3
Biological Activity: Obtusinaphthalenside B is a novel naphthyl glycoside compound that can be isolated from Cassia obtusifolia seeds. Cassia obtusifolia has physiological functions related to neuroprotection, anti-inflammation, and hepatoprotection.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Obtusinaphthalenside B | Obtusinaphthalenside B is a novel naphthyl glycoside compound that can be isolated from Cassia obtusifolia seeds. Cassia obtusifolia has physiological functions related to neuroprotection, anti-inflammation, and hepatoprotection. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||