2648403-17-0
Chemical Structure
THR-β agonist 1
- CAS No.: 2648403-17-0
- Formula:C17H14Cl2FN5O4
- Molecular Weight:442.23
IUPAC Name: 2-(3,5-dichloro-4-((5-isopropyl-6-oxo-1,6-dihydropyridazin-3-yl)oxy)phenyl)-6-(fluoromethyl)-1,2,4-triazine-3,5(2H,4H)-dione
InChIKey: GJJDEZUDUGNRKU-UHFFFAOYSA-N
SMILES: O=C(N1)N(C2=CC(Cl)=C(OC(C=C3C(C)C)=NNC3=O)C(Cl)=C2)N=C(CF)C1=O
Biological Activity: THR-β Agonist 1 is a potent and selective agonist of THRβ. Thyroid hormone receptor mediates the physiological activity of thyroid hormones which plays a key role in normal growth and development of the body and in maintaining metabolic balance. THR-β Agonist 1 has the potential for the research of thyroid hormone receptor-related diseases (extracted from patent WO2021104288A1, compound 2)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
THR-β agonist 1 | 98.66% | THR-β Agonist 1 is a potent and selective agonist of THRβ. Thyroid hormone receptor mediates the physiological activity of thyroid hormones which plays a key role in normal growth and development of the body and in maintaining metabolic balance. THR-β Agonist 1 has the potential for the research of thyroid hormone receptor-related diseases (extracted from patent WO2021104288A1, compound 2). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||