2650073-66-6
Chemical Structure
MED6-189
- CAS No.: 2650073-66-6
- Formula:C17H26N2O
- Molecular Weight:274.40
SMILES: [H][C@]12CC[C@@](C#N)([C@@H]([C@@]1([C@H](CC[C@@]2(C#N)C)C(C)C)[H])O)C
Biological Activity: MED6-189, a kalihinol analog, disrupts apicoplast function and vesicular trafficking in P. falciparum malaria (IC50 < 50 nM). MED6-189 targets the apicoplast, a nonphotosynthetic plastid found in most Apicomplexa parasites that is crucial for the synthesis of isoprenoids[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
MED6-189 | MED6-189, a kalihinol analog, disrupts apicoplast function and vesicular trafficking in P. falciparum malaria (IC50 < 50 nM). MED6-189 targets the apicoplast, a nonphotosynthetic plastid found in most Apicomplexa parasites that is crucial for the synthesis of isoprenoids. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords