2692623-90-6
Chemical Structure
2-Hydroxypalmitic acid-d30
Synonym(s): 2-Hydroxyhexadecanoic acid-d30
- CAS No.: 2692623-90-6
- Formula:C16H2D30O3
- Molecular Weight:302.61
IUPAC Name: 8-((1S,5R)-4-oxo-5-((Z)-pent-2-en-1-yl-4,4,5,5,5-d5)cyclopent-2-en-1-yl)octanoic acid
InChIKey: JGHSBPIZNUXPLA-KXTBTSROSA-N
SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])(O)C(O)=O
Biological Activity: 2-Hydroxypalmitic acid-d30 (2-Hydroxyhexadecanoic acid-d30) is the d30 labeled 2-Hydroxypalmitic acid (HY-N7814). 2-Hydroxypalmitic acid is an intermediate in the phytosphingosine metabolic pathway. 2-Hydroxypalmitic acid is exclusively incorporated into sphingolipids and not used for other lipids. 2-Hydroxypalmitic acid promotes the production of odd-carbon phosphatidylcholine species. 2-Hydroxypalmitic acid is applicable to studies of Saccharomyces cerevisiae infection[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2-Hydroxypalmitic acid-d30 | 2-Hydroxypalmitic acid-d30 (2-Hydroxyhexadecanoic acid-d30) is the d30 labeled 2-Hydroxypalmitic acid (HY-N7814). 2-Hydroxypalmitic acid is an intermediate in the phytosphingosine metabolic pathway. 2-Hydroxypalmitic acid is exclusively incorporated into sphingolipids and not used for other lipids. 2-Hydroxypalmitic acid promotes the production of odd-carbon phosphatidylcholine species. 2-Hydroxypalmitic acid is applicable to studies of Saccharomyces cerevisiae infection. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Hydroxypalmitic acid (Standard) | ≥98% | 2-Hydroxypalmitic acid (Standard) is the analytical standard of 2-Hydroxypalmitic acid (HY-N7814). This product is intended for research and analytical applications. 2-Hydroxypalmitic acid is an intermediate in the phytosphingosine metabolic pathway. 2-Hydroxypalmitic acid is exclusively incorporated into sphingolipids and not used for other lipids. 2-Hydroxypalmitic acid promotes the production of odd-carbon phosphatidylcholine species. 2-Hydroxypalmitic acid is applicable to studies of Saccharomyces cerevisiae infection. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2-Hydroxypalmitic acid | 99.42% | 2-Hydroxypalmitic acid is an intermediate in the phytosphingosine metabolic pathway. 2-Hydroxypalmitic acid is exclusively incorporated into sphingolipids and not used for other lipids. 2-Hydroxypalmitic acid promotes the production of odd-carbon phosphatidylcholine species. 2-Hydroxypalmitic acid is applicable to studies of Saccharomyces cerevisiae infection. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
