2749281-80-7
Chemical Structure
Azido-PEG3-SSPy
- CAS No.: 2749281-80-7
- Formula:C13H20N4O3S2
- Molecular Weight:344.46
IUPAC Name: 2-((2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl)disulfanyl)pyridine
InChIKey: SKOJGYNLNMOKDO-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCSSC1=NC=CC=C1
Biological Activity: Azido-PEG3-SSPy is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Azido-PEG3-SSPy is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG3-SSPy | 98.62% | Azido-PEG3-SSPy is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG3-SSPy is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||