288862-83-9
Chemical Structure
PHOP
- CAS No.: 288862-83-9
- Formula:C18H18N2O2
- Molecular Weight:294.35
IUPAC Name: 1-(oxazolo[4,5-b]pyridin-2-yl)-6-phenylhexan-1-one
InChIKey: VPZHQLPAKFVGKX-UHFFFAOYSA-N
SMILES: O=C(CCCCCC1=CC=CC=C1)C2=NC3=C(O2)C=CC=N3
Biological Activity: PHOP is a fatty acid amide hydrolase (FAAH) inhibitor used to assess inhibitory activity in a fluorometric assay. PHOP can determine FAAH activity by measuring the amount of 4-pyridin-1-ylbutyric acid released by the enzyme in rat brain microsomes. PHOP demonstrates potential as a FAAH inhibitor and can directly measure FAAH activity by reversed-phase HPLC and fluorescence detection, providing a basis for the development of new inhibitors.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PHOP | PHOP is a fatty acid amide hydrolase (FAAH) inhibitor used to assess inhibitory activity in a fluorometric assay. PHOP can determine FAAH activity by measuring the amount of 4-pyridin-1-ylbutyric acid released by the enzyme in rat brain microsomes. PHOP demonstrates potential as a FAAH inhibitor and can directly measure FAAH activity by reversed-phase HPLC and fluorescence detection, providing a basis for the development of new inhibitors. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||