2909443-24-7
Chemical Structure
G092
- CAS No.: 2909443-24-7
- Formula:C23H20Cl2N2O3
- Molecular Weight:443.32
IUPAC Name: (S,E)-3-(6-(1-(3-amino-2,6-dichlorophenyl)ethoxy)-4-cyclopropylquinolin-3-yl)acrylic acid
InChIKey: XJXAZWMUTUJRMD-KFRNIWOLSA-N
SMILES: C[C@@H](C1=C(C=CC(N)=C1Cl)Cl)OC2=CC3=C(N=CC(/C=C/C(O)=O)=C3C4CC4)C=C2
Biological Activity: G092 is a potent inhibitor of MsbA. MsbA is an ABC transporter. Transmembrane ATP-binding cassette (ABC) transporters are crucial cellular machines that move molecules small and large across membranes. G092 has the potential for the research of antimicrobial agents[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
G092 | G092 is a potent inhibitor of MsbA. MsbA is an ABC transporter. Transmembrane ATP-binding cassette (ABC) transporters are crucial cellular machines that move molecules small and large across membranes. G092 has the potential for the research of antimicrobial agents. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||