3036243-81-6
Chemical Structure
FKBP12 ligand-2
- CAS No.: 3036243-81-6
- Formula:C24H25Cl2N3O4S
- Molecular Weight:522.44
InChIKey: ZVYUKWNJYACWIE-IMRHEYAYSA-N
SMILES: O=C1[C@H]2N(S(C3=CC(Cl)=CC(Cl)=C3)(=O)=O)[C@@H]([C@@H](CN1CC4=NC=CC=C4)COCC#C)CCC2
Biological Activity: FKBP12 ligand-2 (compound d) is a high affinity ligand targeting FKBP12. FKBP12 ligand-2 can be used to selectively enhance the binding of heterobifunctional molecules to BRD4, enriching the drug intracellularly through the "CellTrap" effect to form a ternary complex of FKBP12-ligand-BRD4. This ternary complex has inhibitory activity against BRD4, thereby inhibiting the expression of BRD4 target genes (such as MYC) and inducing tumor cell death. FKBP12 ligand-2 can be used for selective cancer research based on differences in intracellular presenter protein levels[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
FKBP12 ligand-2 | FKBP12 ligand-2 (compound d) is a high affinity ligand targeting FKBP12. FKBP12 ligand-2 can be used to selectively enhance the binding of heterobifunctional molecules to BRD4, enriching the drug intracellularly through the "CellTrap" effect to form a ternary complex of FKBP12-ligand-BRD4. This ternary complex has inhibitory activity against BRD4, thereby inhibiting the expression of BRD4 target genes (such as MYC) and inducing tumor cell death. FKBP12 ligand-2 can be used for selective cancer research based on differences in intracellular presenter protein levels. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
