3036374-26-9
Chemical Structure
FKBP12 ligand-3
- CAS No.: 3036374-26-9
- Formula:C25H27Cl2N3O4S
- Molecular Weight:536.47
InChIKey: KMRTWJHGYQMOLW-QWAURFOWSA-N
SMILES: O=C(N([C@@H](C)C1=NC=CC=C1)C[C@@H]2COCC#C)[C@@]3([H])N([C@]2([H])CCC3)S(C4=CC(Cl)=CC(Cl)=C4)(=O)=O
Biological Activity: FKBP12 ligand-3 (compound dj) is a high-affinity ligand targeting FKBP12. FKBP12 ligand-3 can be used to selectively enhance the binding of heterobifunctional molecules to BRD4, enriching the drug intracellularly through the "CellTrap" effect to form a ternary complex of FKBP12-ligand-BRD4. This ternary complex has inhibitory activity against BRD4, thereby inhibiting the expression of BRD4 target genes (such as MYC) and inducing tumor cell death. FKBP12 ligand-3 can be used for selective cancer research based on differences in intracellular presenter protein levels[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
FKBP12 ligand-3 | FKBP12 ligand-3 (compound dj) is a high-affinity ligand targeting FKBP12. FKBP12 ligand-3 can be used to selectively enhance the binding of heterobifunctional molecules to BRD4, enriching the drug intracellularly through the "CellTrap" effect to form a ternary complex of FKBP12-ligand-BRD4. This ternary complex has inhibitory activity against BRD4, thereby inhibiting the expression of BRD4 target genes (such as MYC) and inducing tumor cell death. FKBP12 ligand-3 can be used for selective cancer research based on differences in intracellular presenter protein levels. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||