3038319-82-0
Chemical Structure
Harzianol M
- CAS No.: 3038319-82-0
- Formula:C20H30O4
- Molecular Weight:334.45
SMILES: CC1([C@]23[C@](C[C@@]1(CC[C@H]3CO)O)([H])[C@@]4(C)C(C(C4)=O)=C([C@H](O)C2)C)C
Biological Activity: Harzianol M is found in Trichoderma sp. SCSIOW21. Harzianol M can inhibit the production of NO and exhibit anti-inflammatory activity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Harzianol M | Harzianol M is found in Trichoderma sp. SCSIOW21. Harzianol M can inhibit the production of NO and exhibit anti-inflammatory activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||