3043797-88-9
Chemical Structure
Lysosomal P-gp targeted agent 1
- CAS No.: 3043797-88-9
- Formula:C39H34N2O9S
- Molecular Weight:706.76
InChIKey: VLMGEMFEVKCHIO-UHFFFAOYSA-N
SMILES: OC1=CC=C(C=C1OC2=CC=C(C=C2)CCC3=CC=CC(OCCCOC4=NO[N+]([O-])=C4S(=O)(C5=CC=CC=C5)=O)=C3O6)CCC7=CC6=CC=C7
Biological Activity: Lysosomal P-gp targeted agent 1 (Compound 14) is an anti-tumor agent targeting lysosomal P-glycoprotein (Pgp). Lysosomal P-gp targeted agent 1 is selectively transported into lysosomes by overexpressed Pgp, release nitric oxide (NO) to generate reactive oxygen species (ROS), resulting in lysosomal membrane permeabilization (LMP) and inducing apoptosis. Lysosomal P-gp targeted agent 1 can overcome P-glycoprotein-mediated drug resistance and lead to cell cycle arrest, but relatively low toxicity to normal cells. Lysosomal P-gp targeted agent 1 has antitumor activity, significantly inhibits tumor volume[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lysosomal P-gp targeted agent 1 | Lysosomal P-gp targeted agent 1 (Compound 14) is an anti-tumor agent targeting lysosomal P-glycoprotein (Pgp). Lysosomal P-gp targeted agent 1 is selectively transported into lysosomes by overexpressed Pgp, release nitric oxide (NO) to generate reactive oxygen species (ROS), resulting in lysosomal membrane permeabilization (LMP) and inducing apoptosis. Lysosomal P-gp targeted agent 1 can overcome P-glycoprotein-mediated drug resistance and lead to cell cycle arrest, but relatively low toxicity to normal cells. Lysosomal P-gp targeted agent 1 has antitumor activity, significantly inhibits tumor volume. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||