3056259-55-0
Chemical Structure
CB039
- CAS No.: 3056259-55-0
- Formula:C23H23N5O5S
- Molecular Weight:481.52
InChIKey: HVECTFRQMGHQRA-QGZVFWFLSA-N
SMILES: CC1=C2C(NC=C2C#N)=C(C=C1)NS(C3=CC=CC(NC(C(N4[C@H](CCC4)CO)=O)=O)=C3)(=O)=O
Biological Activity: CB039 is a selective a molecular glue degrader that targets RBM39 (RNA-binding protein 39). CB039 promotes the formation of a ternary complex between RBM39 and the E3 ubiquitin ligase CUL4-DCAF15, leading to proteasomal degradation of RBM39. CB039 is promising for research of cancers with RBM39 dependency, such as acute myeloid leukemia (AML) and ovarian cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CB039 | 98.10% | CB039 is a selective a molecular glue degrader that targets RBM39 (RNA-binding protein 39). CB039 promotes the formation of a ternary complex between RBM39 and the E3 ubiquitin ligase CUL4-DCAF15, leading to proteasomal degradation of RBM39. CB039 is promising for research of cancers with RBM39 dependency, such as acute myeloid leukemia (AML) and ovarian cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords