3082858-70-3
Chemical Structure
EBNA-1 (386–405 aa)
- No. CAS: 3082858-70-3
- Formula:C90H145N33O28
- Molecular Weight:2137.32
SMILES: O=C([C@H]1N(CCC1)C([C@H](CCCNC(N)=N)NC([C@H](CCCNC(N)=N)NC([C@H]2N(CCC2)C([C@H]3N(CCC3)C([C@H](CO)NC(CNC([C@H](CO)NC([C@H](CO)NC([C@H](CO)NC([C@H](CO)NC([C@H](CCC(N)=O)NC([C@@H](N)CO)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)N4[C@@H](CCC4)C(N5[C@@H](CCC5)C(NCC(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCNC(N)=N)C(N6[C@@H](CCC6)C(N[C@H](C(O)=O)CC7=CC=CC=C7)=O)=O)=O)=O)=O)=O
Biological Activity: EBNA-1 (386-405 aa) is a cross-reactive viral antigen peptide. EBNA-1 (386-405 aa) has a high molecular similarity to GlialCAM (370-389 aa) and it induces the production of cross-reactive antibodies that recognize both EBV antigens and glial cells in the central nervous system, thereby triggering autoimmune responses. EBNA-1 (386-405 aa) can used for Epstein-Barr virus (EBV) infection and multiple sclerosis (MS) research[1].
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
EBNA-1 (386–405 aa) | EBNA-1 (386-405 aa) is a cross-reactive viral antigen peptide. EBNA-1 (386-405 aa) has a high molecular similarity to GlialCAM (370-389 aa) and it induces the production of cross-reactive antibodies that recognize both EBV antigens and glial cells in the central nervous system, thereby triggering autoimmune responses. EBNA-1 (386-405 aa) can used for Epstein-Barr virus (EBV) infection and multiple sclerosis (MS) research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords