3091879-37-4
Chemical Structure
Cyanine 3 DBCO chloride
- CAS. Nr.: 3091879-37-4
- Formula:C51H57ClN4O2
- Molecular Weight:793.48
SMILES: CC1(C)C2=C(C=CC=C2)[N+](CCCCCC(NCCCCCC(N3CC(C=CC=C4)=C4C#CC5=C3C=CC=C5)=O)=O)=C1/C=C/C=C6C(C)(C)C(C=CC=C7)=C7N\6C.[Cl-]
Biological Activity: Cyanine 3 DBCO chloride is a click chemistry reagent containing an cycloalkynes group. Cyanine 3 DBCO chloride is a linker of Cyanine5.5 fluorophore. DBCO group enables copper free biocompatible click chemistry with fast reaction kinetics and good stability (Ex/Em = 550/570 nm).
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cyanine 3 DBCO chloride | Cyanine 3 DBCO chloride is a click chemistry reagent containing an cycloalkynes group. Cyanine 3 DBCO chloride is a linker of Cyanine5.5 fluorophore. DBCO group enables copper free biocompatible click chemistry with fast reaction kinetics and good stability (Ex/Em = 550/570 nm). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords