3091879-41-0
3091879-41-0
Chemical Structure
Cyanine 5.5 DBCO chloride
- CAS No.: 3091879-41-0
- Formula:C61H63ClN4O2
- Molecular Weight:919.63
SMILES: O=C(CCCCC[N+]1=C(/C=C/C=C/C=C2C(C)(C)C(C(C=CC=C3)=C3C=C4)=C4N\2C)C(C)(C)C5=C1C=CC6=C5C=CC=C6)NCCCCCC(N7C(C=CC=C8)=C8C#CC(C=CC=C9)=C9C7)=O.[Cl-]
Biological Activity: Cyanine 5.5 DBCO chloride is a click chemistry reagent containing an cycloalkynes group. Cyanine 5.5 DBCO chloride is a linker of Cyanine5.5 fluorophore. DBCO group enables copper free biocompatible click chemistry with fast reaction kinetics and good stability (Ex/Em = 680/715 nm)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cyanine 5.5 DBCO chloride | Cyanine 5.5 DBCO chloride is a click chemistry reagent containing an cycloalkynes group. Cyanine 5.5 DBCO chloride is a linker of Cyanine5.5 fluorophore. DBCO group enables copper free biocompatible click chemistry with fast reaction kinetics and good stability (Ex/Em = 680/715 nm). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
Keywords
