32450-26-3
Chemical Structure
Cochlioquinone B
- CAS No.: 32450-26-3
- Formula:C28H40O6
- Molecular Weight:472.61
IUPAC Name: (3R,4aR,6aR,12aR,12bR)-3-(2-hydroxypropan-2-yl)-6a,12b-dimethyl-9-((2S,4S)-4-methyl-3-oxohexan-2-yl)-1,2,3,4a,5,6,6a,12,12a,12b-decahydropyrano[3,2-a]xanthene-8,11-dione
InChIKey: NTPNSKLZWVYKGK-WWURSIHSSA-N
SMILES: O=C(C([C@H](C)C([C@@H](C)CC)=O)=C1)C2=C(C[C@]3([H])[C@](CC[C@H](C(C)(O)C)O4)(C)[C@@]4([H])CC[C@@]3(C)O2)C1=O
Biological Activity: Cochlioquinone is a sesquiterpene metabolite originally isolated from C. miyabeanus. It is a phytotoxin that inhibits root growth of finger millet (E. coracana) and rice plants (O. sativa) by 59.9 and 51.7%, respectively, when used at a concentration of 100 ppm.2 Cochlioquinone B inhibits NADH oxidase and NADH-2,3-dimethoxy-5-pentyl-1,4-benzoquinone reductase from bovine heart mitochondria.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cochlioquinone B | Cochlioquinone is a sesquiterpene metabolite originally isolated from C. miyabeanus. It is a phytotoxin that inhibits root growth of finger millet (E. coracana) and rice plants (O. sativa) by 59.9 and 51.7%, respectively, when used at a concentration of 100 ppm.2 Cochlioquinone B inhibits NADH oxidase and NADH-2,3-dimethoxy-5-pentyl-1,4-benzoquinone reductase from bovine heart mitochondria. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
