35590-69-3
Chemical Structure
Cyclo(L-Ile-L-Ala)
- CAS No.: 35590-69-3
- Formula:C9H16N2O2
- Molecular Weight:184.24
InChIKey: JDRIJDPCYNFZIT-ACZMJKKPSA-N
SMILES: CC[C@@H]([C@@]1([H])C(N[C@H](C(N1)=O)C)=O)C
Biological Activity: Cyclo (L-Ile-L-Ala) is a cyclic dipeptide (2,5-diketopiperazine). Cyclo (L-Ile-L-Ala) self-assembles into ordered two-dimensional lamellae in hexafluoroisopropanol; increasing concentrations lead to the formation of larger, more complex lamellae. Cyclo (L-Ile-L-Ala) self-assembles into fibrous structures in methanol, and its self-assembly process is sensitive to solvent conditions and building block concentrations[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cyclo(L-Ile-L-Ala) | 98.89% | Cyclo (L-Ile-L-Ala) is a cyclic dipeptide (2,5-diketopiperazine). Cyclo (L-Ile-L-Ala) self-assembles into ordered two-dimensional lamellae in hexafluoroisopropanol; increasing concentrations lead to the formation of larger, more complex lamellae. Cyclo (L-Ile-L-Ala) self-assembles into fibrous structures in methanol, and its self-assembly process is sensitive to solvent conditions and building block concentrations. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||