39022-38-3
Chemical Structure
Sphaeropsidin B
- CAS No.: 39022-38-3
- Formula:C20H28O5
- Molecular Weight:348.43
IUPAC Name: (2R,4aR,4bR,8aS,9S,10R)-4a,9,10-trihydroxy-2,8,8-trimethyl-2-vinyl-2,4,4a,5,6,7,8,8a,9,10-decahydro-3H-9,4b-(epoxymethano)phenanthren-12-one
InChIKey: XJXDJAQAAAVDCT-RHOFUAETSA-N
SMILES: O[C@@]12[C@@]34[C@@](C(C)(CCC4)C)([H])[C@](OC3=O)([C@@H](C1=C[C@](C)(CC2)C=C)O)O
Biological Activity: Sphaeropsidin B is a pimarane diterpene and phytotoxin. Sphaeropsidin B can be found in Diplodia cupressi and Diplodia corticola. Sphaeropsidin B induces phytotoxic effects in plants. Sphaeropsidin B can be used for the research of plant injury-related research areas[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Sphaeropsidin B | Sphaeropsidin B is a pimarane diterpene and phytotoxin. Sphaeropsidin B can be found in Diplodia cupressi and Diplodia corticola. Sphaeropsidin B induces phytotoxic effects in plants. Sphaeropsidin B can be used for the research of plant injury-related research areas. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
