402941-23-5
Chemical Structure
JAG-1, scrambled
Synonym(s): scJag-1
- CAS No.: 402941-23-5
- Formula:C93H127N25O26S3
- Molecular Weight:2107.35
SMILES: OC(C=C1)=CC=C1C[C@@H](C(NCC(N[C@@H](CCCNC(N)=N)C(N[C@H](C(N[C@@H](CCCCN)C(N[C@H](C(N[C@@H](CS)C(N[C@H](C(O)=O)CC2=CC=CC=C2)=O)=O)CC3=CC=C(C=C3)O)=O)=O)CC4=CC=C(C=C4)O)=O)=O)=O)NC([C@H](CC(N)=O)NC([C@H](CC(O)=O)NC([C@H](CC5=CC=CC=C5)NC([C@H](CS)NC([C@H](CC(O)=O)NC([C@H]6N(CCC6)C(CNC([C@H](CS)NC([C@@H](N)CCCNC(N)=N)=O)=O)=O)=O)=O)=O)=O)=O)=O
Biological Activity: JAG-1, scrambled (scJag-1) is a scrambled sequence of JAG-1 (Jagged-1 protein). JAG-1, scrambled has a random sequence of the amino acids that are the same as the active fragment. JAG-1, scrambled is usually used as a negative control[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
JAG-1, scrambled | JAG-1, scrambled (scJag-1) is a scrambled sequence of JAG-1 (Jagged-1 protein). JAG-1, scrambled has a random sequence of the amino acids that are the same as the active fragment. JAG-1, scrambled is usually used as a negative control. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||