402958-62-7
402958-62-7
Chemical Structure
6-(tert-Butoxy)-6-oxohexanoic NHS ester
- CAS No.: 402958-62-7
- Formula:C14H21NO6
- Molecular Weight:299.32
IUPAC Name: tert-butyl (2,5-dioxopyrrolidin-1-yl) adipate
InChIKey: XMOQYFHEYDMGSR-UHFFFAOYSA-N
SMILES: O=C(OC(C)(C)C)CCCCC(ON1C(CCC1=O)=O)=O
Biological Activity: 6-(tert-Butoxy)-6-oxohexanoic NHS ester has a t-butyl ester group and an NHS ester moiety. The t-butyl group can be deprotected under acidic conditions. NHS ester can react specifically and efficiently with primary amines such as the side chain of lysine residues or aminosilane-coated surfaces at neutral or slightly basic condition to form a covalent bond.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
6-(tert-Butoxy)-6-oxohexanoic NHS ester | 6-(tert-Butoxy)-6-oxohexanoic NHS ester has a t-butyl ester group and an NHS ester moiety. The t-butyl group can be deprotected under acidic conditions. NHS ester can react specifically and efficiently with primary amines such as the side chain of lysine residues or aminosilane-coated surfaces at neutral or slightly basic condition to form a covalent bond. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
