4418-26-2
Chemical Structure
Dehydroacetic acid sodium
Synonym(s): Sodium dehydroacetate
- CAS No.: 4418-26-2
- Formula:C8H7NaO4
- Molecular Weight:190.13
IUPAC Name: sodium 3-acetyl-6-methyl-2,4-dioxo-3,4-dihydro-2H-pyran-3-ide
InChIKey: YIOCQGHBBNGBND-UHFFFAOYSA-N
SMILES: CC([C-](C(O1)=O)C(C=C1C)=O)=O.[Na+]
Biological Activity: Dehydroacetic acid sodium, a pyrone derivative acts as an antibacterial and antifungal agent. Dehydroacetic acid possess phytotoxic activity[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dehydroacetic acid sodium | 99.87% | Dehydroacetic acid sodium, a pyrone derivative acts as an antibacterial and antifungal agent. Dehydroacetic acid possess phytotoxic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dehydroacetic acid sodium (Standard) | ≥98% | Dehydroacetic acid (sodium) (Standard) is the analytical standard of Dehydroacetic acid (sodium). This product is intended for research and analytical applications. Dehydroacetic acid sodium, a pyrone derivative acts as an antibacterial and antifungal agent. Dehydroacetic acid possess phytotoxic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||