470462-57-8
Chemical Structure
Pentetic acid-13C5
Synonym(s): Diethylenetriaminepentaacetic acid-13C5; DTPA-13C5
- CAS No.: 470462-57-8
- Formula:C913C5H23N3O10
- Molecular Weight:398.31
IUPAC Name: 2,2',2'',2'''-((((carboxymethyl-13C)azanediyl)bis(ethane-2,1-diyl))bis(azanetriyl))tetraacetic-2-13C acid
InChIKey: QPCDCPDFJACHGM-ODDIWHJLSA-N
SMILES: OC([13CH2]N(CCN(CCN([13CH2]C(O)=O)[13CH2]C(O)=O)[13CH2]C(O)=O)[13CH2]C(O)=O)=O
Biological Activity: Pentetic acid-13C5 (Diethylenetriaminepentaacetic acid-13C5) is the 13C-labeled Pentetic acid (HY-B1335). Pentetic acid (Diethylenetriaminepentaacetic acid) is an orally active compound with biodegradability used to construct magnetic adsorbent, which can simultaneously remove heavy metal and dye from complex wastewater. Pentetic acid can form strong metal complexes, which prevents metal ions from catalysing the decomposition of peroxygen chemicals, especially hydrogen peroxide[1][2][3][4].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pentetic acid-13C5 | Pentetic acid-13C5 (Diethylenetriaminepentaacetic acid-13C5) is the 13C-labeled Pentetic acid (HY-B1335). Pentetic acid (Diethylenetriaminepentaacetic acid) is an orally active compound with biodegradability used to construct magnetic adsorbent, which can simultaneously remove heavy metal and dye from complex wastewater. Pentetic acid can form strong metal complexes, which prevents metal ions from catalysing the decomposition of peroxygen chemicals, especially hydrogen peroxide. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Pentetic acid (Standard) | ≥98% | Pentetic acid (Standard) is the analytical standard of Pentetic acid. This product is intended for research and analytical applications. Pentetic acid is a compound used to construct magnetic adsorbent, which can simultaneously remove heavy metal and dye from complex wastewater. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Pentetic acid | 99.80% | Pentetic acid (Diethylenetriaminepentaacetic acid) is an orally active compound with biodegradability used to construct magnetic adsorbent, which can simultaneously remove heavy metal and dye from complex wastewater. Pentetic acid can form strong metal complexes, which prevents metal ions from catalysing the decomposition of peroxygen chemicals, especially hydrogen peroxide. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
