52657-01-9
Chemical Structure
Multiflorin B
- CAS No.: 52657-01-9
- Formula:C27H30O15
- Molecular Weight:594.52
InChIKey: ZCSDEGFPWXFQLB-WRHRXROUSA-N
SMILES: O=C(C(O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O[C@@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO)O)O)=C(C3=CC=C(C=C3)O)OC4=CC(O)=C5)C4=C5O
Biological Activity: Multiflorin B (compound 5) is a kind of kaempferol glycoside. Multiflorin B can be isolated from the root of the fern Neocheiropteris palmatopedata. Multiflorin B inhibits nitric oxide production at a concentration of 20 μg/ml with an inhibition of 52%[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Multiflorin B | 98.51% | Multiflorin B (compound 5) is a kind of kaempferol glycoside. Multiflorin B can be isolated from the root of the fern Neocheiropteris palmatopedata. Multiflorin B inhibits nitric oxide production at a concentration of 20 μg/ml with an inhibition of 52%. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||