62697-41-0
Chemical Structure
(S)-Bopindolol
- CAS No.: 62697-41-0
- Formula:C23H28N2O3
- Molecular Weight:380.48
InChIKey: UUOJIACWOAYWEZ-SFHVURJKSA-N
SMILES: O=C(C1=CC=CC=C1)O[C@@H](CNC(C)(C)C)COC2=C3C(NC(C)=C3)=CC=C2
Biological Activity: (S)-Bopindolol is a β-adrenergic receptor blocker that can be used to prevent, inhibit, can be used to reduce muscle mass and/or functional loss and/or decreased bone density caused by weight loss. (S)-Bopindolol can protect the myocardium and/or cardiac function, or prevent low blood pressure and/or increased heart rate during weight loss[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(S)-Bopindolol | (S)-Bopindolol is a β-adrenergic receptor blocker that can be used to prevent, inhibit, can be used to reduce muscle mass and/or functional loss and/or decreased bone density caused by weight loss. (S)-Bopindolol can protect the myocardium and/or cardiac function, or prevent low blood pressure and/or increased heart rate during weight loss. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||