666847-71-8
Chemical Structure
5-Propargylamino-3'-azidomethyl-dCTP
- CAS No.: 666847-71-8
- Formula:C13H20N7O13P3
- Molecular Weight:575.26
IUPAC Name: ((2R,3S,5R)-5-(4-amino-5-(3-aminoprop-1-yn-1-yl)-2-oxopyrimidin-1(2H)-yl)-3-(azidomethoxy)tetrahydrofuran-2-yl)methyl tetrahydrogen triphosphate
InChIKey: SHCGONLEPWBTFI-HBNTYKKESA-N
SMILES: O=C1N([C@H]2C[C@H](OCN=[N+]=[N-])[C@@H](COP(OP(OP(O)(O)=O)(O)=O)(O)=O)O2)C=C(C(N)=N1)C#CCN
Biological Activity: 5-Propargylamino-3'-azidomethyl-dCTP is a nucleoside molecule extracted from patent WO2004018497A2, compound 17. 5-Propargylamino-3'-azidomethyl-dCTP can be used in DNA synthesis and DNA sequencing[1]. 5-Propargylamino-3'-azidomethyl-dCTP is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-Propargylamino-3'-azidomethyl-dCTP | 5-Propargylamino-3'-azidomethyl-dCTP is a nucleoside molecule extracted from patent WO2004018497A2, compound 17. 5-Propargylamino-3'-azidomethyl-dCTP can be used in DNA synthesis and DNA sequencing. 5-Propargylamino-3'-azidomethyl-dCTP is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
