72139-14-1
Chemical Structure
Reactive yellow 25
- CAS No.: 72139-14-1
- Formula:C26H14Cl2N7Na3O10S2
- Molecular Weight:788.44
IUPAC Name: sodium 4-((5-(2,3-dichloroquinoxaline-6-carboxamido)-2-sulfonatophenyl)diazenyl)-1-(2-methyl-4-sulfonatophenyl)-5-oxo-4,5-dihydro-1H-pyrazole-3-carboxylate
InChIKey: QVDFDCWLEKWNMS-IIWZCXMMSA-K
SMILES: O=C(C(C1N=NC2=CC(NC(C3=CC=C4N=C(Cl)C(Cl)=NC4=C3)=O)=CC=C2S(=O)(O[Na])=O)=NN(C5=CC=C(S(=O)(O[Na])=O)C=C5C)C1=O)O[Na]
Biological Activity: Reactive yellow 25 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Reactive yellow 25 | Reactive yellow 25 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||