727721-37-1
Chemical Structure
PT-ttpy
- CAS No.: 727721-37-1
- Formula:C22H17Cl2N3Pt
- Molecular Weight:589.38
InChIKey: UWAUJHRZLKCPPX-UHFFFAOYSA-L
SMILES: [Cl-][Pt+2]12[N]3=C(C4=CC(C5=CC=C(C)C=C5)=CC(C6=[N]2C=CC=C6)=[N]41)C=CC=C3.[Cl-]
Biological Activity: Pt-ttpy, a metallo-organic complex and potent G-quadruplex ligand, effectively triggers substantial telomere-related DNA damage in cancer cells by inhibiting telomerase and/or telomere functions, while also causing various chromatin abnormalities during mitosis, such as chromatin bridges, ultrafine bridges (UFBs), and double-stranded breaks (DSBs).
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PT-ttpy | 98.0% | Pt-ttpy, a metallo-organic complex and potent G-quadruplex ligand, effectively triggers substantial telomere-related DNA damage in cancer cells by inhibiting telomerase and/or telomere functions, while also causing various chromatin abnormalities during mitosis, such as chromatin bridges, ultrafine bridges (UFBs), and double-stranded breaks (DSBs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||