72829-25-5
Chemical Structure
Reactive red 24:1
- CAS No.: 72829-25-5
- Formula:C27H19ClN7Na3O10S3
- Molecular Weight:802.10
IUPAC Name: sodium 5-((4-chloro-6-(ethyl(phenyl)amino)-1,3,5-triazin-2-yl)amino)-4-hydroxy-3-((2-sulfonatophenyl)diazenyl)naphthalene-2,7-disulfonate
InChIKey: QJCOOZSSWORRPC-UHFFFAOYSA-K
SMILES: O=S(C1=C(N=NC2=CC=CC=C2S(=O)(O[Na])=O)C(O)=C3C(NC4=NC(Cl)=NC(N(CC)C5=CC=CC=C5)=N4)=CC(S(=O)(O[Na])=O)=CC3=C1)(O[Na])=O
Biological Activity: Reactive red 24:1 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Reactive red 24:1 | Reactive red 24:1 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||