7575-23-7
Chemical Structure
Pentaerythritol tetra3-mercaptopropionate
- CAS No.: 7575-23-7
- Formula:C17H28O8S4
- Molecular Weight:488.66
IUPAC Name: 2,2-bis(((3-mercaptopropanoyl)oxy)methyl)propane-1,3-diyl bis(3-mercaptopropanoate)
InChIKey: JOBBTVPTPXRUBP-UHFFFAOYSA-N
SMILES: O=C(CCS)OCC(COC(CCS)=O)(COC(CCS)=O)COC(CCS)=O
Biological Activity: Pentaerythritol tetra(3-mercaptopropionate)It is a class of organic compounds containing both pentaerythritol and mercaptopropionate groups. It is commonly used as a stabilizer and crosslinking agent in various chemical and industrial applications. Pentaerythritol tetra(3-mercaptopropionate)Has a variety of properties that make it suitable for these applications, including the ability to increase the mechanical strength, thermal stability and weatherability of polymers and coatings. Additionally, it can be used as a feedstock for the production of other specialty chemicals and materials.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pentaerythritol tetra3-mercaptopropionate | 95.0% | Pentaerythritol tetra(3-mercaptopropionate)It is a class of organic compounds containing both pentaerythritol and mercaptopropionate groups. It is commonly used as a stabilizer and crosslinking agent in various chemical and industrial applications. Pentaerythritol tetra(3-mercaptopropionate)Has a variety of properties that make it suitable for these applications, including the ability to increase the mechanical strength, thermal stability and weatherability of polymers and coatings. Additionally, it can be used as a feedstock for the production of other specialty chemicals and materials. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||