80458-11-3
Chemical Structure
Oganomycin GA
- CAS No.: 80458-11-3
- Formula:C23H24N2O13S2
- Molecular Weight:600.57
InChIKey: ZXJVXUCPNNUOQI-ROOIWUQASA-N
SMILES: OC(CCCC(N[C@]1([C@]2([H])N(C(C(O)=O)=C(CS2)COC(/C=C/C3=CC=C(C=C3)OS(=O)(O)=O)=O)C1=O)OC)=O)=O
Biological Activity: Oganomycin GA is Streptomyces str. oganonensis Y-G 19Z and Oganomycin A is produced when p-hydroxycinnamate sodium salt is added to the fermentation medium. Under the action of D-amino acid oxidase, A generates glutaryl derivative, GA; A and GA were converted to B and GB by acid hydrolysis to remove sulfate esters. The effect of B on d-amino acid oxidase was also changed to GB. A and B were more stable than A and B of cemycin, and had stronger effect against Gram-positive and Gram-negative bacteria than Gram-positive bacteria[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Oganomycin GA | Oganomycin GA is Streptomyces str. oganonensis Y-G 19Z and Oganomycin A is produced when p-hydroxycinnamate sodium salt is added to the fermentation medium. Under the action of D-amino acid oxidase, A generates glutaryl derivative, GA; A and GA were converted to B and GB by acid hydrolysis to remove sulfate esters. The effect of B on d-amino acid oxidase was also changed to GB. A and B were more stable than A and B of cemycin, and had stronger effect against Gram-positive and Gram-negative bacteria than Gram-positive bacteria. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||