82145-55-9
Chemical Structure
2'-epi-2'-O-Acetylthevetin B
Synonym(s): GHSC-74
- CAS No.: 82145-55-9
- Formula:C44H68O19
- Molecular Weight:901.00
InChIKey: ILSCMGXPNCDKNU-NLGBLHKOSA-N
SMILES: O[C@@]12[C@@]3([H])[C@@](CC[C@@]1([C@@H](C(CO4)=CC4=O)CC2)C)([H])[C@@]5([C@](C[C@H](CC5)O[C@H]6[C@H]([C@@H]([C@H]([C@@H](O6)C)O[C@@H]7O[C@@H]([C@H]([C@@H]([C@H]7O)O)O)CO[C@@H]8O[C@@H]([C@H]([C@@H]([C@H]8O)O)O)CO)OC)OC(C)=O)([H])CC3)C
Biological Activity: 2'-epi-2'-O-Acetylthevetin B (GHSC-74) is a cardiac glycoside that can be isolated from the seeds of Cerbera manghas L. 2'-epi-2'-O-Acetylthevetin B inhibits cell viability, induces apoptosis and loss of mitochondrial membrane potential in HepG2 cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2'-epi-2'-O-Acetylthevetin B | 2'-epi-2'-O-Acetylthevetin B (GHSC-74) is a cardiac glycoside that can be isolated from the seeds of Cerbera manghas L. 2'-epi-2'-O-Acetylthevetin B inhibits cell viability, induces apoptosis and loss of mitochondrial membrane potential in HepG2 cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||