824426-32-6
Chemical Structure
Aeide-C1-NHS ester
- CAS No.: 824426-32-6
- Formula:C6H6N4O4
- Molecular Weight:198.14
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 2-azidoacetate
InChIKey: FENNDBOWHRZLTQ-UHFFFAOYSA-N
SMILES: O=C(ON1C(CCC1=O)=O)CN=[N+]=[N-]
Biological Activity: Aeide-C1-NHS ester is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Aeide-C1-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Aeide-C1-NHS ester | 98.0% | Aeide-C1-NHS ester is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs. Aeide-C1-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||