83036-64-0
Chemical Structure
Ingenol 3-monobenzoate
Synonym(s): Ingenol 3-benzoate
- CAS No.: 83036-64-0
- Formula:C27H32O6
- Molecular Weight:452.54
InChIKey: VYLJAGRINUHTSF-KNOVOCADSA-N
SMILES: O[C@@]12[C@]3(C=C([C@@H]2OC(C4=CC=CC=C4)=O)C)C([C@](C=C([C@H]1O)CO)([H])[C@@]5([H])[C@@](C5(C)C)([H])C[C@H]3C)=O
Biological Activity: Ingenol 3-monobenzoate (Ingenol 3-benzoate) is a disgust inducing agent. Ingenol 3-monobenzoate can bind to and activate PKC (Ki=0.14 nM), inhibit the gene expression of phosphoenolpyruvate carboxykinase, thereby inhibiting gluconeogenesis, and increasing blood cortisol levels, producing food aversion[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ingenol 3-monobenzoate | 97.30% | Ingenol 3-monobenzoate (Ingenol 3-benzoate) is a disgust inducing agent. Ingenol 3-monobenzoate can bind to and activate PKC (Ki=0.14 nM), inhibit the gene expression of phosphoenolpyruvate carboxykinase, thereby inhibiting gluconeogenesis, and increasing blood cortisol levels, producing food aversion. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||