845673-16-7
Chemical Structure
Glucodichotomine B
- CAS No.: 845673-16-7
- Formula:C20H22N2O9
- Molecular Weight:434.40
IUPAC Name: 1-((R)-2-hydroxy-1-(((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)ethyl)-9H-pyrido[3,4-b]indole-3-carboxylic acid
InChIKey: WQKKQBMRVKDLBP-GOPHKZMVSA-N
SMILES: OC[C@@H](C1=C(NC2=CC=CC=C32)C3=CC(C(O)=O)=N1)O[C@@H]([C@@H]([C@H]4O)O)O[C@@H]([C@H]4O)CO
Biological Activity: Glucodichotomine B (Compound 13) is a natural product which can be isolated from the roots of Chinese medicinal plant Stellaria dichotoma L. var. lanceolata. Glucodichotomine B shows antitumor activity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Glucodichotomine B | Glucodichotomine B (Compound 13) is a natural product which can be isolated from the roots of Chinese medicinal plant Stellaria dichotoma L. var. lanceolata. Glucodichotomine B shows antitumor activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||