846549-37-9
Chemical Structure
2-((Azido-PEG8-carbamoyl)methoxy)acetic acid
- CAS No.: 846549-37-9
- Formula:C22H42N4O12
- Molecular Weight:554.59
IUPAC Name: 32-azido-5-oxo-3,9,12,15,18,21,24,27,30-nonaoxa-6-azadotriacontanoic acid
InChIKey: WWDNBBVPYDZICO-UHFFFAOYSA-N
SMILES: O=C(O)COCC(NCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O
Biological Activity: 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2-((Azido-PEG8-carbamoyl)methoxy)acetic acid | 98.59% | 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
