868594-42-7
Chemical Structure
Benzyl-PEG7-azide
- CAS No.: 868594-42-7
- Formula:C21H35N3O7
- Molecular Weight:441.52
IUPAC Name: 22-azido-1-phenyl-2,5,8,11,14,17,20-heptaoxadocosane
InChIKey: PGBIDYWSWSMVQU-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCC1=CC=CC=C1
Biological Activity: Benzyl-PEG7-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Benzyl-PEG7-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Benzyl-PEG7-azide | Benzyl-PEG7-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Benzyl-PEG7-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||