87402-88-8
Chemical Structure
(-)-Denudatin B
Synonym(s): Denudatin B
- CAS No.: 87402-88-8
- Formula:C21H24O5
- Molecular Weight:356.41
IUPAC Name: (2S,3R,3aR)-5-allyl-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-3,3a-dihydrobenzofuran-6(2H)-one
InChIKey: VDYACOATPFOZIO-HBUDHLSFSA-N
SMILES: CO[C@@]12C(O[C@@](C3=CC(OC)=C(C=C3)OC)([H])[C@H]1C)=CC(C(CC=C)=C2)=O
Biological Activity: (-)-Denudatin B is an antiplatelet agent. (-)-Denudatin B relaxed vascular smooth muscle by inhibiting the Ca2+ influx through voltage-gated and receptor-operated Ca2+ channels[1]. And (-)-Denudatin B has nonspecific antiplatelet action
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(-)-Denudatin B | 97.88% | (-)-Denudatin B is an antiplatelet agent. (-)-Denudatin B relaxed vascular smooth muscle by inhibiting the Ca2+ influx through voltage-gated and receptor-operated Ca2+ channels. And (-)-Denudatin B has nonspecific antiplatelet action | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||