878495-58-0
Chemical Structure
LANA
- CAS No.: 878495-58-0
- Formula:C95H167N35O29S3
- Molecular Weight:2359.75
SMILES: O=C(N[C@@H](C)C(N1[C@@H](CCC1)C(N2[C@@H](CCC2)C(NCC(N[C@@H](CCSC)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC(C)C)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CO)C(NCC(N[C@@H](CCCNC(N)=N)C(N[C@@H](CO)C(N[C@@H]([C@H](O)C)C(NCC(N[C@@H](C)C(N3[C@@H](CCC3)C(N[C@@H](CC(C)C)C(N[C@@H]([C@H](O)C)C(N[C@@H](CCCNC(N)=N)C(NCC(N[C@@H](CO)C(N[C@@H](CS)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@@H](CCSC)N
Biological Activity: LANA is a KSHV latency-associated nuclear antigen. The core function of LANA is to act as an "anchor" for the viral genome, attaching it to the chromatin of the host cell. LANA ensures that the episomal DNA of KSHV replicates together with the host chromosome and is evenly distributed among the daughter cells, thereby maintaining the latent infection of the virus in the cell population. LANA can regulate the transcription of viral and host cell genes, and regulate certain host cell genes to promote cell survival. LANA can be used to study the viral DNA tethering structure[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
LANA | LANA is a KSHV latency-associated nuclear antigen. The core function of LANA is to act as an "anchor" for the viral genome, attaching it to the chromatin of the host cell. LANA ensures that the episomal DNA of KSHV replicates together with the host chromosome and is evenly distributed among the daughter cells, thereby maintaining the latent infection of the virus in the cell population. LANA can regulate the transcription of viral and host cell genes, and regulate certain host cell genes to promote cell survival. LANA can be used to study the viral DNA tethering structure. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||