905735-81-1
905735-81-1
Chemical Structure
10-(tert-Butoxy)-10-oxodecanoic NHS ester
- CAS No.: 905735-81-1
- Formula:C18H29NO6
- Molecular Weight:355.43
IUPAC Name: 1-(tert-butyl) 10-(2,5-dioxopyrrolidin-1-yl) decanedioate
InChIKey: XEERYYHKUOCIQX-UHFFFAOYSA-N
SMILES: O=C(CCCCCCCCC(OC(C)(C)C)=O)ON1C(CCC1=O)=O
Biological Activity: 10-(tert-Butoxy)-10-oxodecanoic NHS ester has a t-butyl ester group and an NHS ester moiety. The t-butyl group can be deprotected under acidic conditions. NHS ester can react specifically and efficiently with primary amines such as the side chain of lysine residues or aminosilane-coated surfaces at neutral or slightly basic condition to form a covalent bond.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
10-(tert-Butoxy)-10-oxodecanoic NHS ester | 10-(tert-Butoxy)-10-oxodecanoic NHS ester has a t-butyl ester group and an NHS ester moiety. The t-butyl group can be deprotected under acidic conditions. NHS ester can react specifically and efficiently with primary amines such as the side chain of lysine residues or aminosilane-coated surfaces at neutral or slightly basic condition to form a covalent bond. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
