918785-00-9
Chemical Structure
Neohelmanthicin B
- CAS No.: 918785-00-9
- Formula:C29H42O10
- Molecular Weight:550.64
InChIKey: XUNRIPMOCLNINU-BOPPCVMBSA-N
SMILES: CCCCCCCC(O[C@@H](C)[C@@](C)(O)C(O[C@@H](C)[C@@H](C1=CC(OC)=C(OCO2)C2=C1)OC(/C(C)=C\C)=O)=O)=O
Biological Activity: Neohelmanthicin B is a phenylpropanoid that can be isolated from Thapsia garganica. Neohelmanthicin B exhibits cytotoxicity against EL4, S180 and MCF7 cell lines with IC50s of 10, 5 and12 μM, respectively[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Neohelmanthicin B | Neohelmanthicin B is a phenylpropanoid that can be isolated from Thapsia garganica. Neohelmanthicin B exhibits cytotoxicity against EL4, S180 and MCF7 cell lines with IC50s of 10, 5 and12 μM, respectively. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||