932311-85-8
Chemical Structure
G243-1720
- CAS No.: 932311-85-8
- Formula:C21H28ClN3O3S
- Molecular Weight:437.98
InChIKey: QJDVOMDNBMNOMJ-UHFFFAOYSA-N
SMILES: CC1=CC=C(C(Cl)=C1)NS(=O)(C2=C(N(C(C)=C2C(N3CCCCCC3)=O)C)C)=O
Biological Activity: G243-1720 is a potent, orally active, broad-spectrum anti-orthopoxvirus agent that functions by targeting the OPG57 (F13) protein and inducing its dimerization. G243-1720 effectively inhibits the replication of various poxviruses, but has no inhibitory effect on non-poxviruses. G243-1720 prevents the formation of extracellular membrane virus particles and the spread between cells. G243-1720 significantly reduces the viral load of monkeypox virus (MPXV) in the lungs of mice[1]
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
G243-1720 | G243-1720 is a potent, orally active, broad-spectrum anti-orthopoxvirus agent that functions by targeting the OPG57 (F13) protein and inducing its dimerization. G243-1720 effectively inhibits the replication of various poxviruses, but has no inhibitory effect on non-poxviruses. G243-1720 prevents the formation of extracellular membrane virus particles and the spread between cells. G243-1720 significantly reduces the viral load of monkeypox virus (MPXV) in the lungs of mice | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||